ماژول:صندخ/ادوات/شخص

• صندخ/ادوات/شخص/چنگ‌مویی دله ونجه تونی کا بکنین

---

-- Credits:
-- Original from fr:Module:Infobox/Fonctions/Personne
-- forked by وهراني @arwiki (ar:ماژول:صندخ/ادوات/شخص)
-- Version: 20250717

-- أدوات مشتركی که آدمون صندخ وسه لازم وونه
local person = {}
person.description = {"أدوات مشتركی که اشخاص صندخ درون پىدا هسته"}

local localdata = require ('ماژول:صندخ/دیتا')
local generic = require ('ماژول:صندخ/ادوات')

local item = localdata.item or {}

-- اسم

person.description["birthname"] = "نوم، ماری زوون جه"
function person.birthname(params)
    if(type(params) ~= "table") then params = {} end
	return  { 
		type = params.type or 'row',
		label = params.label or 'نوم، ماری زوون جه',
		value = params.value or 'نوم ماری زوون جه',
		wikidata = {
			wikimod = 'Wikidata.Ca',
			property = 'P1559', conjunction = '<br />'
		},
			metadata = {
				description = "فقط زمونی استفاده بونه که نوم فرق هکنه.",
				option = "", 
				type = "",
			}
	}

end

person.description["othernames"] = "دیگه اسم‌ئون"
function person.othernames()
	return 
	{type = 'multi', rows = {
		{type = 'row', label = 'تولدِ نوم', 
			value = {'تولد نوم', 'birth name'},
			wikidata = {
				wikimod = 'Wikidata.Ca', showsomevalue = false,
				formatting = 'table', rowformat = '{{$0}}$R0$1', 
				property = 'P1477', listrank='bestrank',
				qualifier = 'P1721', 	rowsubformat1 = ' ($1)', 
				colformat0 = 'native name|1=$language|2=$text',
				conjunction = '<br />'
				},
			metadata = {
				description = "فقط زمونی استفاده بونه که نوم فرق هکنه.",
				option = "", 
				type = "",
			}
		},
		{type = 'row', label = 'رسمی نوم', 
			value = {'رسمی نوم','نام اصلی', 'official name'},
			wikidata = {
				wikimod = 'Wikidata.Ca',
				formatting = 'table', rowformat = '$0$R0$1',
				property = 'P1448', 
				qualifier = 'P1721',  
				rowsubformat1 = ' ($1)', 
				conjunction = '<br />'
				},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{type = 'row', label = 'لقب', 
			value = {'لقب', 'nickname'},
			wikidata = {
				wikimod = 'Wikidata.Ca', formatting = 'table',
				property = 'P1449',  rowformat = '{{$0}}$R0$1',
				qualifier = 'P1721',   rowsubformat1 = ' ($1)', 
				colformat0 = 'native name|1=$language|2=$text',
				conjunction = '<br />'
				},
			metadata = {
				description = " شخص لقب(ون).",
				option = "", 
				type = "",
			}
		},
		{type = 'row', label = 'مستعار نوم', 
			value = {'مستعار نوم','نام مستعار','اسم مستعار','pseudonym'}, 
			wikidata = {
				wikimod = 'Wikidata.Ca',
				formatting = 'table', rowformat = '$0$R0$1',
				property = 'P742', 
				qualifier = 'P1721', rowsubformat1 = ' ($1)', 
				conjunction = '<br />'
				},
			metadata = {
				description = 'مستعار نوم في الأعمال', 
				option = "", 
				type = "",
			}
		},
		{type = 'row', label = 'محترمونه نوم', 
			value = {'درباری نوم','نام محترمانه','محترمونه اسم','محترمانه اسم', 'courtesy name'},
			wikidata = {
				wikimod = 'Wikidata.Ca',
				formatting = 'table', rowformat = '$0$R0$1',
				property = 'P1782', 
				qualifier = 'P1721',  rowsubformat1 = ' ($1)', 
				conjunction = '<br />'
				},
			metadata = {
				description = 'الاسم المستعمل للمجاملة', 
				option = "", 
				type = "",
			}
		},
		{type = 'row', label = 'بمرده‌په نوم', 
			value = {'بمردن په نوم','بمرده په نوم','بمردن‌په نوم' , 'posthumous name'},
			wikidata = {
				wikimod = 'Wikidata.Ca',
				formatting = 'table', rowformat = '$0$R0$1',
				property = 'P1786', 
				qualifier = 'P1721', rowsubformat1 = ' ($1)', 
				conjunction = '<br />'
				},
			metadata = {
				description = 'البمردن په نوم','بمرده په نوم','بمردن‌په نوم', 
				option = "", 
				type = "",
			}
		},
		{type = 'row', label = 'قَورِ سرِ نوم' ,
			value =  {'مزار نوم','قور نوم','قبر نوم' , 'temple name'},
			wikidata = {
				wikimod = 'Wikidata.Ca',
				property = 'P1785', 
				qualifier = 'P1721', formatting = 'table', 
				rowformat = '$0$R0$1', rowsubformat1 = ' ($1)', 
				conjunction = '<br />'
				},
			metadata = {
				description = 'قَورِ سرِ نوم' ,
				option = "", 
				type = "",
			}
		},
		{type = 'row', label = 'هنری نوم' ,
			value = {'هنری نوم' , 'art_name'}, 
			wikidata = {
				wikimod = 'Wikidata.Ca',
				formatting = 'table', rowformat = '$0$R0$1',
				property = 'P1787', 
				qualifier = 'P1721',  rowsubformat1 = ' ($1)', 
				conjunction = '<br />'
			},
			metadata = {
				description = "هنری نوم",
				option = "", 
				type = "",
			}
		},
		{type = 'row', label = 'اختصاری نوم', 
			value = {'اختصاری نوم', 'short name'},
			wikidata = {
				wikimod = 'Wikidata.Ca',
				formatting = 'table', rowformat = '$0$R0$1',
				property = 'P1813', 
				qualifier = 'P1721', rowsubformat1 = ' ($1)', 
				conjunction = '<br />'
			},
			metadata = {
				description = 'اختصاری نوم', 
				option = "", 
				type = "",
			}
		},
		{type = 'row', label = 'دیگر اسمون', 
			value = {'نام دیگر', 'دیگر اسمون','other_name'},
			metadata = {
				description = "أسماء آخر مشهور بها غير تلك المذكورة في اسم واسم ولادة.",
				option = "", 
				type = "",
			}
		},
	}
 }
end

-- =  =  = تواريخ
	
local dead = #mw.wikibase.getBestStatements( item.id or 'Q5' , 'P570' ) > 0 or nil  -- boolean value

-- بزا و بمرد روز

person.description["birth"] = "دنیا بموئن (تاريخ و مكان)"
function person.birth() --  تولد تاریخ اولین خط و ونه مکان دومین خط کفنه
	return {
		type = 'row',
		label = 'بزا-روز',
		metadata = {
			description = "اگه {{تولد و عمر تاریخ}} شابلون جه کار بزنین بتتره.",
			option = "", 
			type = "",
		},
		value = {'ميلاد','ولادة','birth'},
		wikidata = {
			wikimod = 'Wikidata.Ca', sep = " ",
			wikidata = {
				value = localdata.getValue({'بزاروز','بزا روز','تولد','ولادت','دنیا بموئن سال','تاریخ_تولد','birth_date'}), 
				property = 'P569', listrank = "bestrank", 
				conjunction = ' یا '},
			wikidata3 = {
				value = localdata.getValue({'محل_تولد','بزاجا','بزا-جا','دنیا بموئن جا','محل تولد','birth_place'}) , 
				property = 'P19', listrank = "bestrank", 
				conjunction = ' یا ', 
				before = "<div>", after = "</div>"},
			wikidata2 = not(dead) and {
				func = 'yearsOld', 
				formatting = 'unit' , 
				before = '<span style = "white-space:nowrap;">(', 
				after = ')</span>'
			}
		},
	}
end

person.description["death"] = "بمردن (تاريخ ومكان)"
function person.death() 
 return
	{type = 'multi', rows = {
		{ -- گوم بیّن
			type = 'row',
			label = 'گوم بیّن',
			value = {'گوم بین','disappearance'},
			wikidata = {property = "P746"},
			metadata = {
				description = "کاجه و کِی گوم بیه",
				option = "", 
				type = "",
			}
		},
		{ -- بمردن
			type = 'row',
			label = 'بمردن',
			value = {'بمردن','تاریخ مرگ', 'بمردن','مرگ','درگذشت','death'},
			wikidata = { wikimod = 'Wikidata.Ca', sep = " ",
				wikidata = {
					value = localdata.getValue({'بمردی روز','تاریخ درگذشت','بمردن_تاریخ','سالمرگ','بمردن روز','بمردنی‌روز','بمردن تاریخ','مرگ تاریخ','تاریخ درگذشت','تاریخ_درگذشت','بمردن روز','بمردن سال','مرگ سال','death_date'}),
					property = 'P570', listrank = 'bestrank',
					conjunction = ' یا '
	             },
				wikidata2 = {
					func = 'yearsOld',
					formatting = 'unit' ,
					before = '<span style = "white-space:nowrap;">(', 
					after = ')</span>'
				},
				wikidata3 = {
					value = localdata.getValue({'بمردن جا','محل درگذشت','محل مرگ','death_place'}) ,
					property = 'P20',
					listrank = 'bestrank', conjunction = ' یا ',
					formatting = 'table', rowformat = "$0$R0$1",
					qualifier1 = 'P131 OR P17',
					rowsubformat1 = "<small><br />($2 $3)</small>",
					qualifier2 = "P17", qualifier3 = "P131", 
					before = "<div>", after = "</div>"
				}
			},
			metadata = {
			description = "اگه {{بمردن و عمر تاریخ}} شابلون ره کار بزنین بتتر هسته .",
				option = "", 
				type = "",
			}
		}
	}}
end

person.description["mannerOfDeath"] = "بمردن وضعیت"
function person.mannerOfDeath()
	return 
	{type = 'multi', rows = {
		{
			type = 'row',
			label = 'بمردن وضعیت',
			value = {'بمردن وضع','manner of death'},
			wikidata = {wikimod = 'Wikidata.Ca', property = 'P1196', formatting='table', rowformat='$0$R0', blacklist0='Q3739104'},
			metadata = {
				description = "الظروف العامة لوفاة الشخص كالأسباب الطبيعية أو الحوادث أو الانتحار أو القتل",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'بمردن دلیل', plurallabel = 'بمردن دلایل',
			value = {'بمردن دلیل','cause of death'},
			wikidata = {property = 'P509'},
			metadata = {
				description = "أسباب الوفاة المباشرة أو الخفية (مثل: حادث سيارة أو سرطان المعدة).",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row', 
			label = 'قاتل', 
			value = {'قاتل','killer'},
			wikidata = {property = 'P157', conjunction = '<br />'},
			metadata = {
				description = "اسم قاتل",
				option = "", 
				type = "",
			}
		},
	}}
end

person.description["floruit"] = "دوره"
function person.floruit()
	return {
		type = 'row',
		label = "دوره",
		value = {'سال‌های فعالیت', 'فعالیت دوره','دوره فعالیت',},
		wikidata = {
			wikimod = 'Wikidata.Ca', 
			property = 'P2031', qualifier = '/P2032', qualifier2 = 'P276',
			formatting = 'table', rowformat = '$2 شروع $0$1 جه' , 
			rowsubformat1 = ' تا $1'
		},
		wikidata2 = { property = 'P1317' },
		metadata = {
			description = "نطاق سنوات العمل أو الأعمال الرئيسية التي يمارسها / مارسها أو أي أعمال ملحوظة أخرى (استخدم هذا الشكل 1950-2000 أو 1970-الآن).",
			option = "", 
			type = "",
		}
	}
end

person.description["placeofburial"] = 'مِزار'
function person.placeofburial()
	return
		{
			type = 'row', 
			label = 'مِزار', 
			value = {'مدفن', 'مزار','قور','قبر','آرامگاه'},
			wikidata = {
	            wikimod = "Wikidata.Ca",
	            property = "P119", listrank = "bestrank",
	            formatting = "table",
	            qualifier = "P965", qualifier2 = "P625", qualifier3 = "P1545",
	            qualifier4 = "P518",
	            rowformat = "$0$R0$4$1$2", tablesort = '3',
	            colformat1 = ", $1", rowsubformat4 = " ($4)",
	            colformat2 = "<br /><small>[[پرونده:GNOME Maps.svg|20x20px|link = ]] {{Map draw| class = no-icon| type = maplink|$lat,$lon|zoom = 6|text = نقشه سر}}</small>",
	            conjunction = '<br />'
	        },
			metadata = {
				description = "من المفضل ذكر المدينة والمنطقة أو الولاية والدولة (يجب ذكر المعلومات حسب الوضع الحالي وليس وقت الدفن).",
				option = "", 
				type = "",
			}
		}
end

person.description["nationality"] = "ملیت"
function person.nationality() 
	return {
		type = 'row',
		label = 'ملیت',
		plurallabel = 'ملیت',
		value = {'ملیت','تابعیت','nationalité','nationality','citizenship'},
		wikidata = {wikimod = 'Wikidata.Ca', 
			property = 'P27',showDate = 'true', 
			listrank = "bestrank",conjunction = "<br />"
		},
		metadata = {
			description = "کمین کشور آدم بی‌یه.",
			option = "", 
			type = "",
		}
	}

end

person.description["nativelanguage"] = "زوونون"
function person.nativelanguage()
	return
	{
		type = 'row', 
		label = '[[ماری زوون]]', 
		value = {'زبان مادری','ماری_زوون','ماری زوون','first language','langue maternelle'}, 
		wikidata = {property = 'P103'},
		metadata = {
			description = "مار زوون",
			option = "", 
			type = "",
		}
	}
end

-- سکونت

person.description["places"] = "اقامت"
function person.places()
	return 
	{type = 'multi', rows = {
		{
			type = 'row',
			label = 'اقامت',
			value = {'اقامت','جایی که دیه','residence','domicile'},
			wikidata = {
			   wikimod = 'Wikidata.Ca', listrank = 'bestrank',
			   property = 'P263 OR P551', conjunction = "<br />",
			   showDate = 'true'},
			metadata = {
				description = "شهرونی که زندگی کرده ره مدت و سال اقامت همراهی بنشنه لیست هاکردن.",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'کار محل',
			value = {'کار محل','workplace'},
			wikidata = {
			   wikimod = 'Wikidata.Ca', listrank = 'bestrank',
			   property = 'P937', conjunction = "<br />",
			   showDate = 'true', 
			},
			metadata = {
				description = "المكان الذي يعمل / عمل به الشخص، من المفضل ذكر المدينة والمنطقة أو الولاية والدولة والتاريخ.",
				option = "", 
				type = "",
			}
		},
	}}
end

-- حرفه ای زندگی

person.description["education"] = "آخرین جا درس بخوندسته"
function person.education() 
	return {
		type = 'row',
		label = 'تحصیلات',
		value = {'تحصیلات', 'دانشگاه','مدرسه','alma_mater','education', 'formation'},
		wikidata = {
			wikimod = 'Wikidata.Ca',
			formatting = 'table', rowformat = '$0$R0 $1 $4$5',
			property = 'P69', 
			qualifier1 = 'P580 OR P582', rowsubformat1 = "<small>($2 - $3)</small>",
			qualifier2 = 'P580', colformat2 = 'Y',
			qualifier3 = 'P582', colformat3 = 'Y',
			qualifier4 = 'P812',
			qualifier5 = 'P512',

			rowsubformat4 = '<small><br />&nbsp;&nbsp;رشته: $4</small>', 
			rowsubformat5 = '<small><br />&nbsp;&nbsp;مدرک: $5</small>',
			conjunction = "<br />"
		},
		metadata = {
			description = "آخرین مدرکی که شخص دانشگاه دله بهیته.",
			option = "", 
			type = "",
		}
	}
end

person.description["occupation"] = "پیشه"
function person.occupation()
	return {
		type = 'row', 
		label = 'پیشه',	plurallabel = 'پیشه‌ئون',
		value = {'پیشه', 'حرفه', 'زمینه فعالیت', 'زمینه_فعالیت','occupation'},
		wikidata = {
			wikimod = 'Wikidata.Ca', conjunction = '<br />',
			property = 'P106', -- OR P425
			showDate = 'true', case = 'gender'
		},
		metadata = {
			description = " حرفه‌ای و شغلی شخص دمبال کنده.",
			option = "", 
			type = "",
		}
	}
end

person.description["employer"] = "کارفرما"
function person.employer()
	return {
		type = 'row',  
		label = 'کارفرما',
		value = {'کارفرما','employer'},
		wikidata = {
			wikimod = 'Wikidata.Ca', conjunction = '<br />',
			property = 'P108', 
			showDate = 'true'
		},
		metadata = {
			description = "الشركة / الشركات التي عمل بها كموظف.",
			option = "", 
			type = "",
		}
	}
end

person.description["victories"] = "پیروزی"
function person.victories() 
	return {
		type = 'row', 
		label =  'پیروزی(ها)',
		value = {'پیروزی','victoire'}, 
		wikidata = {
			wikimod = 'Wikidata.Ca',
			property = 'P2522', 
			showDate = 'true', 
			conjunction = '<br />'
		},
		metadata = {
			description = "پیروزی",
			option = "", 
			type = "",
		}
	}
end

person.description["officialposition"] = "مقوم"
function person.officialposition() 
  return {type = 'table', title = 'مقوم', rows = {
		{
			type = 'row1col', 
			value = { 'مقوم','مناصب','منصب','عنوان','سمت','position held','function'}, 
			wikidata = {
				wikimod = 'Wikidata.Ca', conjunction = "",
				formatting = "table", listrank = 'bestrank',
				property = "P39",
				case0 = "gender",
				qualifier = "P580",
				rowsubformat1 = "$1&nbsp;– ",
				qualifier2 = "P582",
				
				qualifier15 = "P1365",
				rowsubformat15 = '<span style = "float:right">&rarr;&nbsp;$15</span>',
				qualifier4 = "P1366",
				rowsubformat4 = '<span style = "float:left">– $4&nbsp;&larr;</span>',
				qualifier3 = "P1365 OR P1366",
				rowsubformat3 = "<div>$15 $4</div>",
				
				qualifier5 = "P1545",
				rowsubformat5 = "($5)",
				case5 = "ordinal",
				qualifier6 = "P748 OR P1027",
				rowsubformat6 = '<br /><div style = "float: right;font-size:smaller;">وه ره مقوم هدا: $6</div>',
				qualifier7 = "P608 OR P2389",
				qualifier8 = "P748",
				qualifier9 = "P158 OR P94 OR P39/P158 OR P39/P94",
				rowsubformat9 = "[[پرونده:$9|25x30px|link = ]]",
				qualifier10 = "P708",
				rowsubformat10 = '<br /><div style = "text-align: right;font-size:smaller;">اسقف‌هنیش: $10</div> ',
				qualifier11 = "P5054",
				rowsubformat11 = '<br /><div style = "text-align: right;font-size:smaller;">کابینه: $11</div>',
				qualifier12 = "P1534",
				rowsubformat12 = '&nbsp;<span style = "font-size:85%;">($12)</span>',
				qualifier13 = "P2868",
				rowsubformat13 = 'دوره: $13<br /> ',
				qualifier14 = "P2937",
				rowsubformat14 = '<br /><div style = "text-align: right;font-size:smaller;">پارلمونی دوره: $14</div>',
				rowformat = '<div style = "display: table;width:100%;text-align:center;background-color:#F0F0F0;">$9 $0$R0 $7 $5</div> <div style = "text-align:center;">$13 $1 $2$12 $3 $14 $11 $10 $6</div>',
				tablesort = "1",
				sorting = "-1"
			},
			metadata = {
				description = " ",
				option = "", 
				type = "",
			}
		},
	}}
end

person.description["nobilitytitle"] = "تشریفاتی لقب"
function person.nobilitytitle() 
	return {
		type = 'row', 
		label = 'تشریفاتی لقب', 
		value = {'تشریفاتی لقب','nobility_title'}, 
		wikidata = {
			wikimod = 'Wikidata.Ca',
			property = 'P97', 
			showDate = 'true', 
			conjunction = '<br />'
		},
		metadata = {
			description = "",
			option = "", 
			type = "",
		}
	}
end

person.description["honorifictitle"] = ""
function person.honorifictitle() 
	return {type = 'multi', rows = {
		{
			type = 'row', 
			label = 'اشرافی لقب', 
			value = {'اشرافی لقب','honorific_title'}, 
			wikidata = {
				wikimod = 'Wikidata.Ca',
				property = 'P511', 
				showDate = 'true', 
				conjunction = '<br />'
			},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
	}}

end

person.description["grave"] = ""
function person.grave()
	return {
		type = 'images',
		imageparameters = {'قَور','grave','tombe'},
		defaultimages = nil,
		defaultupright = 1,
		uprightparameter = 'upright grave',
		captionparameter = 'قَورِ جیرنویس',
		defaultcaption = 'قور عکس',
		wikidata = { property = 'P1442',},
		metadata = {
			description = "",
			option = "", 
			type = "",
		}
	}
end
person.tombe = person.grave

person.description["plaque"] = ""
function person.plaque()
	return {
		type = 'images',
		imageparameters = {'پلاک','plaque'},
		defaultimages = nil,
		defaultupright = 1,
		uprightparameter = 'upright plaque',
		captionparameter = 'پلاک جیرنویس',
		defaultcaption = 'پلاک بنویشت',
		property = 'P1801',
		numval = 1,
		metadata = {
			description = "",
			option = "", 
			type = "",
		}
	}
end

person.description["monogram"] = "مونوگرام"
function person.monogram()
	return {
		type = 'images',
		imageparameters = {'مونوگرام','monogram'},
		defaultimages = nil,
		defaultsize = '100px',
		captionparameter = 'مونوگرام جیرنویس',
		defaultcaption = 'مونوگرام',
		property = 'P1543',
		numval = 1,
		metadata = {
			description = "مونوگرام عکس",
			option = "", 
			type = "",
		}
	}
end

person.description["politicalparty"] = "احزاب"
function person.politicalparty()
	return {
		type = 'row', 
		value = {'حزب','سیاسی حزب','حزبون','حزب سیاسی','party','parti politique'},
		label = 'سیاسی حزب',
		wikidata = { 
			wikimod = 'Wikidata.Ca', property = 'P102', 
			showDate = 'true', conjunction = '<br />'
		},
		metadata = {
			description = "حزب و جناح",
			option = "", 
			type = "",
		}
	}
end

person.description["memberof"] = generic.description.memberof
person.memberof = generic.memberof

-- Influences 

person.description["influencedby"] = "المؤثرون"
function person.influencedby()
	return {
		type = 'row',
		label = 'تحت تأثیر',
		value = {'تأثیرپذیرفته', 'تحت تأثیر','influences','تأثیر بئیت','influenced_by'},
		wikidata = {property = 'P737'},
		metadata = {
			description = "الأشخاص أو المجموعات أو الأفكار التي تأثر بها الشخص، الأمثلة الواضحة والملحوظة فقط (تجنب التخمين).",
			option = "", 
			type = "",
		}
    }
end

person.description["influenced"] = "تحت تأثیر"
function person.influenced()
	return {
		type = 'row',
		label = 'تأثیرگذار', 
		value = {'تأثیرات', 'تأثير','influenced','تأثیرگذار','a influencé', 'influence de'},
		metadata = {
			description = "الأشخاص أو المجموعات أو الأفكار التي أثر بها الشخص، الأمثلة الواضحة والملحوظة فقط (تجنب التخمين).",
			option = "", 
			type = "",
		}
}
end

-- الانتماءات

person.description["movement"] = "رِمبِش"
function person.movement()
	return
	{
		type = 'row',
		label = 'رِمبِش',
		value = {'حرکت','جنبش','رمبش','جمبش','movement'},
		wikidata = {wikimod = 'Wikidata.Ca', property = 'P135', showDate = 'true'},
		metadata = {
			description = "الحركات التي انتسب إليها.",
			option = "", 
			type = "",
		}
	}
end

-- الديانة

person.description["religion"] = "الدين والمعتقد"
function person.religion()
	return {type = 'multi', rows = {
		{
			type = 'row',
			label = 'دین',
			plurallabel = 'ادیان',
			value = {'مذهب','ادیان','دین','religion'},
			wikidata = {wikimod = 'Wikidata.Ca',
				property = 'P140', showDate = 'true', 
				formatting = 'table', rowformat = '$0$R0', blacklist0 = 'Q7066'},
			metadata = {
				description = "الديانة التي يعتنقها، يستخدم فقط عند الاستشهاد بمصادر موثوقة.",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'غسل تعمید تاریخ',
			value = 'غسل تعمید تاریخ',
			property = 'P1636',
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'خورد پی‌یر',
			plurallabel = 'خورد پی‌یرون',
			value = 'خورد پی‌یر',
			property = 'P1290',
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'دینی نوم',
			plurallabel = 'دینی اسامی', 
			value = 'دینی نوم',
			wikidata = {property = 'P1635',wikimod = 'Wikidata.Ca',},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
        },
		{
			type = 'row',
			label = 'دینی سیستم', 
			value = 'دینی سیستم',
			wikidata = {wikimod = 'Wikidata.Ca',property = 'P611',},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'مُقدِّس',
			plurallabel = 'مقدسات',
			value = 'مقدس',
			property = 'P1598',
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'وه ره پرستنه',
			value = {'وه ره پرستنه','worshipped by'},
			wikidata = {
				property = 'P1049',
			},
			metadata = {
				description = "الدين أو المجموعة أو الحضارة التي تعظمه",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'تقدیس رتبه',
			value = {'تقدیس رتبه','sainthood status'},
			wikidata = {
				property = 'P411',
			},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
	}}
end

-- نظامی چلّه

person.description["military"] = "نظامی چلّه"
function person.military()
	return {type = 'multi', rows = {
		{
			type = 'row',
			label = 'نظامی چلّه',
			plurallabel = 'نظامی چلّه‌ئون',
			value = {'نظامی چله','military branch'},
			wikidata = {
				wikimod = 'Wikidata.Ca', listrank = "bestrank",
				property = 'P241', 
				showDate = 'true', conjunction = "<br />"
			},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'نظامی واحد',
			plurallabel = 'نظامی واحدون',
			value = {'نظامی واحد','military unit'},
			wikidata = {
				wikimod = 'Wikidata.Ca',  listrank = "bestrank",
				property = 'P7779', 
				showDate = 'true', conjunction = "<br />"
			},
			metadata = {
				description = "الوحدات العسكرية التي انتسب إليها مع ذكر التواريخ",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'نظامی رتبه',
			plurallabel = 'نظامی رتبه‌ئون',
			value = {'نظامی رتبه','military_rank'},
			wikidata = {wikimod = 'Wikidata.Ca', 
				property = 'P410', showDate = 'true',
				conjunction = '<br />'
			},
			metadata = {
				description = 'نظامی رتبه',
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'جنگ که دیّه',
			value = {'جنگون','درگیری‌ها','نبردها','conflict'},
			wikidata = {wikimod = 'Wikidata.Ca', 
				property = 'P607', conjunction = '<br />', 
				showDate = 'true'
			},
			metadata = {
				description = 'النزاعات العسكرية التي شارك فيها وتواريخها',
				option = "", 
				type = "",
			}
		},
	}}
end

-- ورزشی

person.description["sport"] = "ورزشی رشته"
function person.sport()
	return {type = 'multi', rows = {
		{
			type = 'row',
			label = 'ورزشی رشته',
			plurallabel = 'ورزشی رشته‌ئون',
			value = {'ورزشی رشته','رشته ورزشی','ورزش','country_sport'},
			wikidata = {wikimod = 'Wikidata.Ca', property = 'P1532', showDate = 'true'},
			metadata = {
				description = "جنسية البلد الذي يمثله رياضيا.",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'کاکرِ موقعیت',
			value = {'کاکر موقعیت','player position'},
			wikidata = {wikimod = 'Wikidata.Ca', 
				property = 'P413', showDate = "true", conjunction = "<br />"
			},
			metadata = {
				description = "مركز اللاعب في الميدان",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'تخصصی وزرش',
			value = {'تخصصی وزرش','sports discipline'},
			wikidata = {property = 'P2416'},
			metadata = {
				description = 'تخصصی وزرش',
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'شخصی رکورد',
			value = {'شخصی رکورد','personal record'},
			wikidata = {wikimod = 'Wikidata.Ca', 
				listrank = 'bestrank',
				formatting = 'table',
				tablesort = 1,
				sorting = -1,
				property = 'P2415',
				colformat0 = 'unitcode',
				qualifier = 'P585',
				rowsubformat1 = '($1)',
				colformat1 = 'Y',
				qualifier2 = 'P276',
				rowsubformat2 = '&nbsp;← $2',
				qualifier3 = 'P2416 OR P641 OR /P2416 OR /P641',
				qualifier4 = 'P1013/P2910',
				rowsubformat4 = '$4',
				colformat4 = '[[پرونده:$1|18px]]',
				rowformat = '<div style = "background: #eeeeee;"><small>$3</small></div><div>$0 $4$2 $1</div>',
				separator = '<hr>',
				conjunction = '<hr>'
			},
			metadata = {
				description = "أفضل أداء والأرقام القياسية المسجلة",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'دست',
			value = {'دست','playing hand'},
			wikidata = {property = 'P741'},
			metadata = {
				description = "دست و لینگی که ونجه کا کنده",
				option = "", 
				type = "",
				suggestedvalues = {"راست‌دست","چپ‌دست","دِ دست"},
			}
		},
		{
			type = 'row',
			label = 'کپتل',
			value = {'کپل','کپتل',"shooting handedness"},
			wikidata = {property = 'P423'},
			metadata = {
				description = "اليد التي يستعملها لاعب هوكي للقذف",
				option = "", 
				type = "",
				suggestedvalues = {"اليمنى","اليسرى","كلتا اليدين"},
			}
		},
		{
			type = 'row',
			label = 'اولین تیم',
			value = {'اولین تیم'},
			wikidata = {
				wikimod = 'Wikidata.Ca',
				property = 'P647',
				qualifier = 'P585', qualifier2 = 'P1836', 
				formatting = 'table', rowformat = '$0$R0<small><!--$2--> $1</small>',
				rowsubformat1 = '($1)', rowsubformat2 = ', $2' ,
				case2 = 'ordinal' , tablesort = 1 
			},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
    	{type = "row1col", 
    		style = {['background-color'] = '#F3F3F3',['font-weight'] = 'bold'},
    		wikidata = {wikimod = "Wikidata.Ca", property = "P54", listmax = 1,
		    	formatting = "table", editicon = 'false',
		    	rowformat = "تیم"
    		},
    	},
		{
			type = 'row',
			label = 'تیم',
			plurallabel = 'تیم',
			value = {'تیمون','تیم','team'},
		},
		{
			type = 'row',
			label = 'باشگاه',
			plurallabel = 'باشگاه',
			value = {'باشگاه','club'},
			style = {["text-align"] = "right"},
			wikidata = {wikimod = "Wikidata.Ca",
				formatting = 'table',
				property = 'P54', 
				qualifier4 = 'P1350 OR P1351', 
				rowsubformat4 = '<small style = "white-space:nowrap;">($5 $6)</small>',
				qualifier5 = 'P1350', 
				rowsubformat5 = "# کا: $5",
				qualifier6 = 'P1351', 
				rowsubformat6 = "# گُل: $6",
				case6 = function(n) if tonumber(n) > 0 then return n else return '' end end ,
				qualifier1 = 'P580 OR P582', rowsubformat1 = "<small>$2 - $3</small> : ",
				qualifier2 = 'P580', colformat2 = 'Y',
				qualifier3 = 'P582', colformat3 = 'Y',
				rowformat = "$1 $0$R0 $4", tablesort = '2/3',
				conjunction = "<hr style = \"width:50%\">"
				--before = "<div style = \"text-align:right\">",
				--after = "</div>"
			},
			metadata = {
				description = "هرکجه کا بکرده",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'ملّی بازی',
			value = 'ملی بازی',
			wikidata = {property = 'P1129', numval = 1},
			metadata = {
				description = "ملی بازی",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'شطرنجِ مقوم',
			value = {'شطرنج مقوم','chess title'},
			wikidata = {
				wikimod = 'Wikidata.Ca', 
				property = 'P2962', conjunction = "<br />",
				showDate = 'true'
			},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'رتبه ELO',
			value = {'رتبه ELO','elo rating'},
			wikidata = {
				wikimod = 'Wikidata.Ca', 
				formatting = "table", rowformat = "* $0$R0 $1", 
				rowsubformat1 = "<small>($1)</small>",
				property = 'P1087', listmax = 3,
				qualifier1 = 'P585', tablesort = "1", sorting = "-1"},
			metadata = {
				description = 'أخر تصنيف إيلو',
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'بشکست رکورد',
			--plurallabel = 'Records détenus',
			value = {'بشکست رکورد','record held'},
			wikidata = {wikimod = 'Wikidata.Ca', property = 'P1000',  showDate = 'true'},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'مربی',
			plurallabel = 'مربی‌ئون',
			value = {'مربی','coach'},
			wikidata = {wikimod = 'Wikidata.Ca', 
				property = 'P286', 
				showDate = 'true',
				conjunction = "<br />"
			},
			metadata = {
				description = "قائمة الأشخاص الذين أشرف على التدريب (مع ذكر الفترة)",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'کمک راننده',
			--plurallabel = 'Copilotes',
			value = {'کمک راننده','copilot'},
			wikidata = {wikimod = 'Wikidata.Ca', property = 'P2095', showDate = 'true'},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'اسپانسر',
			--plurallabel = 'Sponsors',
			value = {'اسپانسر','sponsor'},
			wikidata = {wikimod = 'Wikidata.Ca', property = 'P859', showDate = 'true'},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
	}}
end
-- سفرهای فضایی

person.description["space"] = ""
function person.space()
	return {type = 'multi', rows = {
		{
			type = 'row',
			label = 'سفرهای فضایی',
			value = {'سفرهای فضایی','space_mission'},
			wikidata = {wikimod = 'Wikidata.Ca', 
				property = 'P450',
				qualifier = 'P450/P154 or P450/P94',
				qualifier2 = 'P450',
				formatting = 'table',
				separator = ',&nbsp;',
				rowformat = '$1$0$R0',
				rowsubformat1 = '[[پرونده:$1|18px|link = $2]]'
             },
			metadata = {
				description = 'الرحلات الفضائية',
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'زمونی که فضا دیّه',
			value = {'زمونی که فضا دیّه','time_in_space'},
			wikidata = {wikimod = 'Wikidata.Ca', property = 'P2873', formatting = 'durationh:m:s'},
			metadata = {
				description = 'زمونی که فضا دیّه',
				option = "", 
				type = "",
			}
		},
        {
			type = 'row',
			label = 'فضا دمجی',
			value = {'فضایی پیاده‌روی','فضا دمجی','spacewalk'},
			wikidata = {wikimod = 'Wikidata.Ca', 
				formatting = 'table',
				tablesort = '1/2',
				sorting = '-1',
				property = 'P793',
				whitelist0 = 'Q182020', -- extravehicular activity
				qualifier = 'P585', --  date
				qualifier2 = 'P580', -- start date
				qualifier3 = 'P582', -- end date
				qualifier4 = 'P518', -- apply to
				qualifier5 = 'P1114', -- quantity
				qualifier6 = 'P2047', -- durada
				rowsubformat1 = '$1&nbsp;',
				rowsubformat2 = '$2-$3&nbsp;',
				rowsubformat4 = '$4:',
				rowsubformat6 = '&nbsp;($6)',
				colformat6 = 'duration',
				rowformat = '$1$2$4$5$6',
            },
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},

	}}
end

-- اشخاص در رابطه

person.description["contacts"] = ""
function person.contacts()
	return {type = 'multi', rows = {
		{
			type = 'row',
			label = localdata['استاد'] or 'استاد',
			--plurallabel = 'Maîtres',
			value = {'مدرس', 'مدرسون'},
			wikidata = {wikimod = 'Wikidata.Ca', property = 'P1066',  showDate = 'true'},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'شاگرد',
			plurallabel = 'شاگردون',
			value = {'شاگرد', 'شاگردون'},
			wikidata = {wikimod = 'Wikidata.Ca',property = 'P802',  showDate = 'true'},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'رساله‌یِ ناظر',
			--plurallabel = 'Directeurs de thèse',
			value = 'رساله ناظر',
			wikidata = {wikimod = 'Wikidata.Ca',property = 'P184',  showDate = 'true'},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = "موکل",
			value = {'موکل','manager'},
			wikidata = {property = 'P1875',  showDate = 'true'},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'هم‌باز',
			value = {'هم‌باز','collaborator'},
			wikidata = {property = 'P1327', conjunction='<br />'},
			metadata = {
				description = "شريك هام في العمل أو الرياضة",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'مهم شخص',
			value = {'مهم شخص','key person'},
			wikidata = {property = 'P3342', qualifier1 = 'P3831', formatting='table', rowformat='$0$R0 $1', rowsubformat1='($1)'},
			metadata = {
				description = "شخصية لها مكانة هامة",
				option = "", 
				type = "",
			}
		},
	}}
end

-- موسيقى

person.description["music"] = ""
function person.music()
	return {type = 'multi', rows = {
		{
			type = 'row',
			label = 'صدایِ رج',
			value = 'صدای رج',
			property = 'P412',
			metadata = {
				description = "درجات تردد الصوت البشري عند الكلام والغناء",
				option = "", 
				type = "", 
				example = "تنور"
			}
		},
		{
			type = 'row',
			label = 'صدایِ تخصص',
			value = {'صدای تخصص','fach'},
			property = 'P1731',
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'ساز',
			--plurallabel = 'ساز',
			value = {'سازها', 'ساز','آلات موسیقی','آلت موسیقی','آلات','musical instrument'},
			wikidata = {property = 'P1303'},
			metadata = {
				description = "ساز",
				option = "", 
				type = "",
				example = "پيانو",
			}
		},
		{
			type = 'row',
			label = 'ضبط کمپانی',
			plurallabel = 'ضبط کمپانی',
			value = 'ضبط کمپانی',
			wikidata = {wikimod = 'Wikidata.Ca',property = 'P264', showDate = 'true'},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
	}}
end

-- قربونی‌ها

person.description["victims"] = ""
function person.victims()
	return {type = 'multi', rows = {
		{ 
			type = 'row', 
			label = 'قربونی‌ها',
			value = {'قربونی','قربونی‌ها','victims'}, 
			wikidata = {property = 'P1345'},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
	}}
end

-- قضایی حکم

person.description["penalties"] = 'اتهاماتی که محکوم بیه'
function person.penalties()
	return {type = 'multi', rows = {
	{
		type = 'row',
		label = 'اتهاماتی که محکوم بیه',
		value = {'اتهامات','محکومیت','اتهام','convicted_of'},
		wikidata = {wikimod = 'Wikidata.Ca',
			property = 'P1399', 
			qualifier1 = 'P580 OR P582', qualifier2 = 'P580', qualifier3 = 'P582', 
			rowsubformat1 = "<small><br />تاريخ : $2 - $3</small>",
			qualifier4 = 'P585', rowsubformat4 = "<small><br />تاريخ: $4</small>",
			qualifier5 ='P1437', rowsubformat5 = '<small><br />رد اتهامات: $5</small>',
			qualifier6 ='P1596', rowsubformat6 = '<small><br />مجازات: $6</small>',
			
			formatting = 'table', rowformat = '* $0$R0 $1$4$5$6'
		},
		metadata = {
			description = "يستخدم فقط للمجرمين المدانين، التهم المنسوبة له، يستخدم فقط عند الاستشهاد بمصادر موثوقة.",
			option = "", 
			type = "",
		}
	},
	{
		type = 'row', 
		label = 'مجازات', 
		value = {'مجازات','sentence'},
		wikidata = {wikimod = 'Wikidata.Ca',property = 'P1596', showDate = 'true'},
		metadata = {
			description = "العقوبة التي يتلقاها / تلقاها، يستخدم فقط عند الاستشهاد بمصادر موثوقة.",
			option = "", 
			type = "",
		}
	},
	{
		type = 'row', 
		label = 'زندون',
		plurallabel = 'زندون‌ها', 
		value = {'زندون','prison'}, 
		wikidata = {
			wikimod = 'Wikidata.Ca',
			property = 'P2632', 
			showDate = 'true',
			conjunction = "<br />"
		},
		metadata = {
			description = "",
			option = "", 
			type = "",
		}
	},
	}}
end

-- مشخصات ظاهری

person.description["appearance"] = "مشخصات ظاهری"
function person.appearance()
	return {type = 'multi', rows = {
	{
		type = 'row',
		label = 'قد',
		value = {'قد','height'},
		wikidata = {
			wikimod = 'Wikidata.Ca',property = 'P2048', colformat0 = 'unitcode',
			showDate = 'true', convert0 = 'default',
			conjunction = "<br />"
		},
		metadata = {
			description = 'طول قامت',
			option = "", 
			type = "",
		}
	},
	{
		type = 'row',
		label = 'وزن',
		value = {'وزن','weight'},
		wikidata = {
			wikimod = 'Wikidata.Ca',property = 'P2067', formatting = 'unitcode',
			showDate = 'true', convert0='default',
			conjunction = "<br />"
		},
		metadata = {
			description = 'وزن (ک‌گ)',
			option = "", 
			type = "",
		}
	},
	{
		type = 'row',
		label = 'دست',
		value = {'دست','hand'},
		wikidata = {property = 'P552'},
		metadata = {
			description = "",
			option = "", 
			type = "",
		}
	},
	{
		type = 'row',
		label = 'میِ رنگ',
		value = {'می','hair'},
		wikidata = {property = 'P1884'},
		metadata = {
			description = 'ونه می چه رنگ هسه',
			option = "", 
			type = "",
		}
	},
	{
		type = 'row',
		label = 'چشِ رنگ',
		value = {'چش','eyecolor'},
		wikidata = {property = 'P1340'},
		metadata = {
			description = 'ونه چش چه رنگ هسه',
			option = "", 
			type = "",
		}
	},
	{
		type = 'row',
		label = 'دیم',
		value = {'دیم','facial feature'},
		wikidata = {wikimod = 'Wikidata.Ca', sep = "<br />",
			wikidata = {property = 'P8852'},    --facial hair
		},
		metadata = {
			description = 'ونه دیم چه ویژگی دارنه',
			option = "", 
			type = "",
		}
	},
	}}
end

-- خانواده

person.description["family"] = "خانواده"
function person.family()
	return 
	{type = 'multi', rows = {
		{ type = 'row',
			label = 'خانواده',
			value = {'خانواده','family'}, 
			wikidata = { property = 'P53'},
			metadata = {
				description = "اسم العائلة المشهورة التي ينتمي إليها.",
				option = "", 
				type = "",
		}},
		{ type = 'row',
			label = 'پی‌یر',
			value = {'پی‌یر','پییر','father'},
			wikidata = {wikimod = 'Wikidata.Ca',
				property = 'P22', conjunction = ' یا ',
				qualifier1 = 'P1039', rowsubformat1 = "<small>($1)</small>",
				formatting = 'table', rowformat = "$0$R0 $1"
			},
			metadata = {
				description = "پی‌یر نوم",
				option = "", 
				type = "",
			}
		},
		{ type = 'row',
			label = 'مار',
			value = {'مار','mother'},
			wikidata = {wikimod = 'Wikidata.Ca',
				property = 'P25', conjunction = ' أو ',
				qualifier1 = 'P1039', rowsubformat1 = "<small>($1)</small>",
				formatting = 'table', rowformat = "$0$R0 $1"
			},
			metadata = {
				description = "مار نوم",
				option = "", 
				type = "",
			}
		},
		{ type = 'row',
			label = 'خورد پی‌یر-مار',
			plurallabel = 'خورد پی‌یر-مار',
			value = {'خورد پییر','خورد مار','خورد پی‌یر','خورد پی‌یر-مار','خورد پییر مار','stepparent'},
			wikidata = {property = 'P3448',conjunction = "<br />"},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{ type = 'row',
			label = 'برار-خاخِر',
			value = {'برار','برارون','خاخر','خاخرون','برار-خاخرون','برار-خاخر','sibling'},
			wikidata = {property = 'P3373'},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'همسر', 
			plurallabel = 'همسرون',

			value = {'همسر','زنا','شی','همسرون','زنان','spouse','husband', 'wife'},
			wikidata = {
				wikimod = 'Wikidata.Ca',
				formatting = 'table' , 
				property = 'P26', 
				qualifier1 = 'P580 OR P582', 
				rowsubformat1 = '<small style = "white-space:nowrap;">($2 - $4 $3)</small>',
				qualifier2 = 'P580', colformat2 = 'Y',
				qualifier3 = 'P582', colformat3 = 'Y',
				qualifier4 = 'P1534', rowsubformat4 = "$4 ",
				rowformat = '$0$R0 $1' , 
				conjunction = "<br />"
			},
			metadata = {
				description = ' اسم الزوج / الزوجة، يذكر بالشكل التالي "الاسم (1950-الآن)" أو "الاسم (1970-1999)".',
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'وچون',
			value = {'وچون','children'},
			wikidata = {
				wikimod = 'Wikidata.Ca',
				property = 'P40', formatting = 'table',
				qualifier = 'P1545',
				qualifier2 = 'P1039' ,
				rowformat = '$0$R0$2',
				rowsubformat2 = ' ($2)',
				tablesort = 1 ,
				conjunction = '<br />'
			},
			wikidata2 = {
				property = 'P1971', showDate='true'
			},
			metadata = {
				description = "عدد الأولاد أو لائحة بأسمائهم (تجنب ذكر أسماء أولاد الشخص إذا كان حيا احتراما للخصوصية إلا إذا كان الولد ملحوظ بشكل مستقل).",
				option = "", 
				type = "",
			}
		},
	{
		type = 'row',
		label = 'فامیل',
		value = {'فامیل','relative'},
		wikidata = {
			wikimod = 'Wikidata.Ca',
			property = 'P1038',
			qualifier = 'P1039',
			formatting = 'table',
			rowformat = '$0 $1', conjunction = "<br />",
			rowsubformat1 = '<small>($1)</small>'  
		},
		metadata = {
			description = "أسماء الأقارب. وتوضع العلاقة بين قوسين بعد الاسم ( عم، الخ).",
			option = "", 
			type = "",
		}
	}
}}
end

-- الرق

person.description["slavery"] = ""
function person.slavery()
	return {type = 'multi', rows = {
		{
			type = 'row',
			label = 'برده/آزاد',
			value = 'برده آزاد',
			wikidata = {
				wikimod = 'Wikidata.Ca',
				property = 'P3716', 
				showDate = 'true',
				formatting = 'table' , rowformat = '$0', whitelist0 = 'Q12773225/Q841571'
			},
			metadata = {
				description = "",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row',
			label = 'صاحاب',
			plurallabels = 'صاحابون',
			value = {'صاحاب','owner'},
			wikidata = {property = 'P127'},
			metadata = {
				description = "في حالة العبودية، ذكر المالك",
				option = "", 
				type = "",
			}
		},
	}}
end

-- مهمترین کارون

person.description["works"] = "مهمترین کارون'"
function person.works(params)
	return 
	{type = 'multi', rows = {
		{
			type = 'row', 
			label = 'مهمترین کارون',
			value = {'مهمترین کارون', 'مهمترین فعالیت', 'کتابون', 'اثر برجسته', 'آثار برجسته', 'شناخته شده برای', 'آثار','مهمترین فعالیت‌ها','notable work'},
			wikidata = {
				wikimod = "Wikidata.Ca",  
				property = 'P800',
                qualifier = 'P571 OR P577 OR P585 OR P800/P571 OR P800/P577 OR P800/P1191 OR P800/P580',
                qualifier2 = 'P800/P582',
                formatting = 'table'  , 
                rowformat = '*$1 $0',
                rowsubformat1 = '<small>($1$2)</small>', 
                rowsubformat2 = '-$2', tablesort = 1 , 
                colformat1 = 'Y' ,colformat2 = 'Y' ,conjunction = '<br />' 
			},
			metadata = {
				description = "عناوين الأعمال البارزة التي قام بها (منشورات، مؤلفات، تماثيل، .إلخ).",
				option = "", 
				type = "",
			}
		}}
	}
end

person.description["filmography"] = "معروفترین فیلم'"
function person.filmography()
	return
	{
        type = 'row', 
        label = 'معروفترین فیلم', 
        value = {'فیلم‌ها', 'معروفترین فیلم','filmography'}, 
        wikidata = {property = 'P1283'} ,
		metadata = {
			description = "عناوين الأفلام البارزة التي قام بها",
			option = "", 
			type = "",
		}
	}
	end

person.description["discography"] = "معروفترین آهنگ'"
function person.discography()
	return
	{
		type = 'row', 
		label = 'معروفترین آهنگ', 
		value = {'معروفترین آهنگ','discography'},
		wikidata = {property = 'P358'},
		metadata = {
			description = "عناوين الأغاني المشهورة التي أداها",
			option = "", 
			type = "",
		}
    }
end

-- امضا 

person.description["signature"] = "امضا "
function person.signature(default)
	local name = localdata.name or mw.title.getCurrentTitle().text
	local alt = 'ونه امضا'

	return {
		type = 'images',
		imageparameters = {'امضا ','signature'},
		defaultimage = default,
		captionparameter = 'امضا جیرنویس',
		defaultcaption = 'امضا',
		uprightparameter = 'upright signature',
		defaultupright = 0.5,
		defaultalt = alt,
		property = 'P109',
		numval = 1,
		metadata = {
			description = "صورة التوقيع (ضع اسم الملف فقط دون السابقة «ملف:» أو «File:»)",
			example = "abc_signature.jpg",
			option = "", 
			type = "wiki-file-name",
		}
	}
end

-- صوت

person.description["voice"] = "صوت"
function person.voice()
	return generic.selectSound({
		defaultcaption = 'ضبط هکرد صدا',
		captionparameter = 'صدای جیرنویس',
		value = {'صوت','voice'},
		defaultsize = '280',
		property = 'P990',
		metadata = {
			description = "صوتی پرونده وسه، ونه اول پرونده: نی‌یلین",
			example = "abc_voice.ogg",
			option = "", 
			type = "wiki-file-name",
		}
	})
end

person.description["languages"] = "گپ بزوئن زوون"
function person.languages()
	return {type = 'multi', rows = {
		person.nativelanguage(),
		{
			type = 'row', 
			label = "گپ بزوئن زوون", 
			value = {'زوون','زبان','زبون','language'},  
			wikidata = {property = 'P1412'},
			metadata = {
				description = "زوونون",
				option = "", 
				type = "",
			}
		},
		{
			type = 'row', 
			label = "زوونی که نوشته", 
			value = {'بنویشتن زوون','writing language'},  
			wikidata = {property = 'P6886'},
			metadata = {
				description = "بنویشتن زوون",
				option = "", 
				type = "",
			}
		}
	}}
end

person.description["haswrittenfor"] = "حامی کتاب"
function person.haswrittenfor()
	return	{
		type = 'row', 
		label = 'حامی', 
		value = {'کنه سه نوشته','writer for'}, 
		wikidata = {
			wikimod = 'Wikidata.Ca',property = "P6872", 
			showDate = "true"
			},
		metadata = {
			description = "کنه سه نوشته",
			option = "", 
			type = "",
		}
	}
end

person.description["worth"] = "مال-منال"
function person.worth()
	return	{
		type = 'row', 
		label = 'مال-منال', 
		value = {'ثروت','داشتی','مال', 'worth'},
		wikidata = {wikimod = 'Wikidata.Ca', 
			formatting = 'table', list = 'firstrank',
			property = 'P2218 or P2121', qualifier = 'P585',
			rowformat = '$0 $1', rowsubformat1 = '<small>($1)</small>',
			colformat0 = 'unit', convert0 = 'M'
		},
		metadata = {
			description = "ونه داشتی و نداشتی",
			option = "", 
			type = "",
		}
	}
end

person.description["works_in_collection"] = 'مجموعه کارون'
function person.works_in_collection()
	return	{
		type = 'row', 
		label = 'مجموعه کارون', 
		value = {'مجموعه کارون', 'works in collection'},
		wikidata = {
			wikimod = 'Wikidata.Ca',
			property = 'P6379', formatting = 'table',
			qualifier1 = 'P6241 OR P1436',
			qualifier2 = 'P6241',
			qualifier3 = 'P1436',
			rowformat = '<p>$0$R0 $1</p>',
			conjunction = '<br />',
			rowsubformat1 = '<small>$2$3</small>',
			rowsubformat2 = '<br />:: منشی : $2',
			rowsubformat3 = '<br />:: گتی : $3',
		},
		metadata = {
			description = "",
			option = "", 
			type = "",
		}
	}
end

person.description["archivesat"] = "تلمبار جا'"
function person.archivesat()
	return	{
		type = 'row', 
		label = 'تلمبار جا', 
		value = {'تلمبار جا', 'archive location'},
		wikidata = {
			wikimod = 'Wikidata.Ca',
			property = 'P485', formatting = 'table',
			qualifier = 'P217',
			qualifier2 = 'P6224',
			qualifier3 = 'P973',
			qualifier4 = 'P518',
			rowformat = '* $0$R0$2 $4 $1 $3',
			conjunction = '<br />',
			rowsubformat1 = ' $1',
			rowsubformat2 = ', $2',
			rowsubformat3 = '[$3]',
			rowsubformat4 = '&larr; $4'
		},
		metadata = {
			description = "مهم اتفاقون",
			option = "", 
			type = "",
		}
	}
end

person.description["significant_events"] = "مهم اتفاقون"
function person.significant_events()
	return	{
		type = 'row', 
		label = 'مهم اتفاقون', 
		value = {'مهم اتفاقون', 'significant_events'},
		wikidata = { wikimod = 'Wikidata.Ca',
			formatting = 'table',
			tablesort = '1/2',
			sorting = '-1',
			property = 'P793',
			blacklist0 = 'Q182020',	 -- extravehicular activity in astronaut block 
			qualifier = 'P580 or P793/P580 or P585 or P793/P585',	 -- start date or date       
			qualifier2 = 'P582 or P793/P582',	 -- end date   
			qualifier3 = 'P710 or P1346 or P3279 or P748 or P1598',	 -- participant, appointed by/ consecrator 
			qualifier4 = 'P276',	 -- location  
			qualifier5 = 'P518',	 -- apply to
			qualifier6 = 'P770',	 -- cause destruct.
			qualifier7 = 'P828',	 -- has caused 
			rowsubformat1 = '$1$2',
			rowsubformat2 = '-$2',
			rowsubformat3 = ', per $3',
			rowsubformat4 = '&nbsp;($4)',
			rowsubformat5 = ':&nbsp;$5',
			rowsubformat6 = '<br/>خرابی باعث: $6',
			rowsubformat7 = '<br/>باعث: $7',
			rowformat = '* <small>$1</small> : $0$5$4$3$6$7',
		},
		metadata = {
			description = "أهم الأحداث التي شهدها",
			option = "", 
			type = "",
		}
	}
end

person.description.title = generic.description.title
person.title = generic.title
-- وب سایت
person.description.website = generic.description.website
person.website = generic.website

person.description.blog = generic.description.blog
person.blog = generic.blog

-- تلفظ
person.description.prononciation = generic.description.prononciation
person.prononciation = generic.pronunciation

person.description.awards = generic.description.awards
person.awards = generic.awards

-- عکسون
person.description.mainimage = generic.description.mainimage
person.mainimage = generic.mainimage

person.description.coat_of_arms = generic.description.coat_of_arms
person.coat_of_arms = generic.coat_of_arms
person.blason = generic.coat_of_arms

person.description.seal = generic.description.seal
person.seal = generic.seal
person.sceau = generic.seal


return person